C15H20OS — CID 66095879
1-cyclopentyl-3-(2-methylphenyl)sulfanylpropan-2-one (PubChem CID 66095879) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2-methylphenyl)sulfanylpropan-2-one.
| Compound Name | 1-cyclopentyl-3-(2-methylphenyl)sulfanylpropan-2-one |
|---|---|
| PubChem CID | 66095879 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-cyclopentyl-3-(2-methylphenyl)sulfanylpropan-2-one |
| SMILES | Cc1ccccc1SCC(=O)CC1CCCC1 |
| InChI | InChI=1S/C15H20OS/c1-12-6-2-5-9-15(12)17-11-14(16)10-13-7-3-4-8-13/h2,5-6,9,13H,3-4,7-8,10-11H2,1H3 |
| InChIKey | QBDHZDYWZRRFGG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |