C16H21NO3S — CID 61011351
2-[1-[2-(2-methylphenyl)sulfanylacetyl]piperidin-2-yl]acetic acid (PubChem CID 61011351) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is 2-[1-[2-(2-methylphenyl)sulfanylacetyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[2-(2-methylphenyl)sulfanylacetyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 61011351 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[1-[2-(2-methylphenyl)sulfanylacetyl]piperidin-2-yl]acetic acid |
| SMILES | Cc1ccccc1SCC(=O)N1CCCCC1CC(=O)O |
| InChI | InChI=1S/C16H21NO3S/c1-12-6-2-3-8-14(12)21-11-15(18)17-9-5-4-7-13(17)10-16(19)20/h2-3,6,8,13H,4-5,7,9-11H2,1H3,(H,19,20) |
| InChIKey | NTSSCHYGQVGTON-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |