C14H17NO3S — CID 61371865
2-[1-(2-phenylsulfanylacetyl)pyrrolidin-2-yl]acetic acid (PubChem CID 61371865) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-[1-(2-phenylsulfanylacetyl)pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-(2-phenylsulfanylacetyl)pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 61371865 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[1-(2-phenylsulfanylacetyl)pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN1C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C14H17NO3S/c16-13(10-19-12-6-2-1-3-7-12)15-8-4-5-11(15)9-14(17)18/h1-3,6-7,11H,4-5,8-10H2,(H,17,18) |
| InChIKey | LUJJEVRYLNWAJO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |