C31H54O3 — CID 157220632
(E)-1-(3,6-dimethoxy-2,4,5-trimethylcyclohexa-1,4-dien-1-yl)-3,7,11,15-tetramethylhexadec-2-en-1-one (PubChem CID 157220632) has the molecular formula C31H54O3 and a molecular weight of 474.77 g/mol. Its IUPAC name is (E)-1-(3,6-dimethoxy-2,4,5-trimethylcyclohexa-1,4-dien-1-yl)-3,7,11,15-tetramethylhexadec-2-en-1-one.
| Compound Name | (E)-1-(3,6-dimethoxy-2,4,5-trimethylcyclohexa-1,4-dien-1-yl)-3,7,11,15-tetramethylhexadec-2-en-1-one |
|---|---|
| PubChem CID | 157220632 |
| Molecular Formula | C31H54O3 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | (E)-1-(3,6-dimethoxy-2,4,5-trimethylcyclohexa-1,4-dien-1-yl)-3,7,11,15-tetramethylhexadec-2-en-1-one |
| SMILES | COC1C(C)=C(C)C(OC)C(C(=O)/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)=C1C |
| InChI | InChI=1S/C31H54O3/c1-21(2)14-11-15-22(3)16-12-17-23(4)18-13-19-24(5)20-28(32)29-27(8)30(33-9)25(6)26(7)31(29)34-10/h20-23,30-31H,11-19H2,1-10H3/b24-20+ |
| InChIKey | IDKQFUBVDDPGHN-HIXSDJFHSA-N |
| XLogP | 8.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|