C15H26N2 — CID 74039330
2-(diethylamino)-4,8-dimethylnona-3,7-dienenitrile (PubChem CID 74039330) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-(diethylamino)-4,8-dimethylnona-3,7-dienenitrile.
| Compound Name | 2-(diethylamino)-4,8-dimethylnona-3,7-dienenitrile |
|---|---|
| PubChem CID | 74039330 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-(diethylamino)-4,8-dimethylnona-3,7-dienenitrile |
| SMILES | CCN(CC)C(C#N)C=C(C)CCC=C(C)C |
| InChI | InChI=1S/C15H26N2/c1-6-17(7-2)15(12-16)11-14(5)10-8-9-13(3)4/h9,11,15H,6-8,10H2,1-5H3 |
| InChIKey | XTTVGEFSYGRCBT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|