C16H22N2O — CID 101233737
2-[(5Z)-6,10-dimethyl-4-oxoundeca-5,9-dien-2-yl]propanedinitrile (PubChem CID 101233737) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[(5Z)-6,10-dimethyl-4-oxoundeca-5,9-dien-2-yl]propanedinitrile.
| Compound Name | 2-[(5Z)-6,10-dimethyl-4-oxoundeca-5,9-dien-2-yl]propanedinitrile |
|---|---|
| PubChem CID | 101233737 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[(5Z)-6,10-dimethyl-4-oxoundeca-5,9-dien-2-yl]propanedinitrile |
| SMILES | CC(C)=CCC/C(C)=C\C(=O)CC(C)C(C#N)C#N |
| InChI | InChI=1S/C16H22N2O/c1-12(2)6-5-7-13(3)8-16(19)9-14(4)15(10-17)11-18/h6,8,14-15H,5,7,9H2,1-4H3/b13-8- |
| InChIKey | LSQKWCPIBDMERU-JYRVWZFOSA-N |
| XLogP | 3.94 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|