C24H30N2O6 — CID 154909912
acetic acid;4-[3-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]phenyl]-3-methoxybenzoic acid (PubChem CID 154909912) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is acetic acid;4-[3-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]phenyl]-3-methoxybenzoic acid.
| Compound Name | acetic acid;4-[3-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]phenyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 154909912 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | acetic acid;4-[3-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]phenyl]-3-methoxybenzoic acid |
| SMILES | CC(=O)O.CCN1CCCC1CNC(=O)c1cccc(-c2ccc(C(=O)O)cc2OC)c1 |
| InChI | InChI=1S/C22H26N2O4.C2H4O2/c1-3-24-11-5-8-18(24)14-23-21(25)16-7-4-6-15(12-16)19-10-9-17(22(26)27)13-20(19)28-2;1-2(3)4/h4,6-7,9-10,12-13,18H,3,5,8,11,14H2,1-2H3,(H,23,25)(H,26,27);1H3,(H,3,4) |
| InChIKey | UDZNBCINJKLKGM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |