About 2,5-dihydroxyterephthalaldehyde;4-phenylaniline
2,5-dihydroxyterephthalaldehyde;4-phenylaniline (PubChem CID 175152805) has the molecular formula C20H17NO4
and a molecular weight of 335.36 g/mol. Its IUPAC name is 2,5-dihydroxyterephthalaldehyde;4-phenylaniline.
Molecular Properties
| Compound Name | 2,5-dihydroxyterephthalaldehyde;4-phenylaniline |
| PubChem CID | 175152805 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2,5-dihydroxyterephthalaldehyde;4-phenylaniline |
| SMILES | Nc1ccc(-c2ccccc2)cc1.O=Cc1cc(O)c(C=O)cc1O |
| InChI | InChI=1S/C12H11N.C8H6O4/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;9-3-5-1-7(11)6(4-10)2-8(5)12/h1-9H,13H2;1-4,11-12H |
| InChIKey | ZDOPXJXUAYZAGQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dihydroxyterephthalaldehyde;4-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydroxyterephthalaldehyde;4-phenylaniline?
The IUPAC name of 2,5-dihydroxyterephthalaldehyde;4-phenylaniline (CID 175152805) is 2,5-dihydroxyterephthalaldehyde;4-phenylaniline.
What is the SMILES notation for 2,5-dihydroxyterephthalaldehyde;4-phenylaniline?
The canonical SMILES for 2,5-dihydroxyterephthalaldehyde;4-phenylaniline is Nc1ccc(-c2ccccc2)cc1.O=Cc1cc(O)c(C=O)cc1O.
What is the InChIKey of 2,5-dihydroxyterephthalaldehyde;4-phenylaniline?
The InChIKey is ZDOPXJXUAYZAGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C8H6O4/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;9-3-5-1-7(11)6(4-10)2-8(5)12/h1-9H,13H2;1-4,11-12H.
What are the key properties of 2,5-dihydroxyterephthalaldehyde;4-phenylaniline?
2,5-dihydroxyterephthalaldehyde;4-phenylaniline has a molecular weight of 335.36 g/mol, XLogP of 3.66, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydroxyterephthalaldehyde;4-phenylaniline is sourced from PubChem (CID 175152805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).