C20H17NO4 — CID 175152805
2,5-dihydroxyterephthalaldehyde;4-phenylaniline (PubChem CID 175152805) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2,5-dihydroxyterephthalaldehyde;4-phenylaniline.
| Compound Name | 2,5-dihydroxyterephthalaldehyde;4-phenylaniline |
|---|---|
| PubChem CID | 175152805 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2,5-dihydroxyterephthalaldehyde;4-phenylaniline |
| SMILES | Nc1ccc(-c2ccccc2)cc1.O=Cc1cc(O)c(C=O)cc1O |
| InChI | InChI=1S/C12H11N.C8H6O4/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;9-3-5-1-7(11)6(4-10)2-8(5)12/h1-9H,13H2;1-4,11-12H |
| InChIKey | ZDOPXJXUAYZAGQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|