About 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol
2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol (PubChem CID 162196265) has the molecular formula C28H28N2O3
and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol |
| PubChem CID | 162196265 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol |
| SMILES | Cc1ccccc1/N=C/c1ccccc1O.Cc1ccccc1N.O=Cc1ccccc1O |
| InChI | InChI=1S/C14H13NO.C7H9N.C7H6O2/c1-11-6-2-4-8-13(11)15-10-12-7-3-5-9-14(12)16;1-6-4-2-3-5-7(6)8;8-5-6-3-1-2-4-7(6)9/h2-10,16H,1H3;2-5H,8H2,1H3;1-5,9H/b15-10+;; |
| InChIKey | ZQZATFFMNWLZPX-OVWKBUNZSA-N |
| XLogP | 6.23 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol?
The IUPAC name of 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol (CID 162196265) is 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol.
What is the SMILES notation for 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol?
The canonical SMILES for 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol is Cc1ccccc1/N=C/c1ccccc1O.Cc1ccccc1N.O=Cc1ccccc1O.
What is the InChIKey of 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol?
The InChIKey is ZQZATFFMNWLZPX-OVWKBUNZSA-N. The full InChI is InChI=1S/C14H13NO.C7H9N.C7H6O2/c1-11-6-2-4-8-13(11)15-10-12-7-3-5-9-14(12)16;1-6-4-2-3-5-7(6)8;8-5-6-3-1-2-4-7(6)9/h2-10,16H,1H3;2-5H,8H2,1H3;1-5,9H/b15-10+;;.
What are the key properties of 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol?
2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol has a molecular weight of 440.54 g/mol, XLogP of 6.23, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzaldehyde;2-methylaniline;2-[(2-methylphenyl)iminomethyl]phenol is sourced from PubChem (CID 162196265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).