C15H20N2O4 — CID 115923695
2-[2-[(2-amino-2-oxoethyl)-(2-methylpropyl)amino]-2-oxoethyl]benzoic acid (PubChem CID 115923695) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[2-[(2-amino-2-oxoethyl)-(2-methylpropyl)amino]-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-[(2-amino-2-oxoethyl)-(2-methylpropyl)amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 115923695 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[2-[(2-amino-2-oxoethyl)-(2-methylpropyl)amino]-2-oxoethyl]benzoic acid |
| SMILES | CC(C)CN(CC(N)=O)C(=O)Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H20N2O4/c1-10(2)8-17(9-13(16)18)14(19)7-11-5-3-4-6-12(11)15(20)21/h3-6,10H,7-9H2,1-2H3,(H2,16,18)(H,20,21) |
| InChIKey | CSWDDMLLTDZNJV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |