C12H13ClF2N2O4 — CID 107440793
2-[(2-amino-2-oxoethyl)-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]amino]acetic acid (PubChem CID 107440793) has the molecular formula C12H13ClF2N2O4 and a molecular weight of 322.70 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 107440793 |
| Molecular Formula | C12H13ClF2N2O4 |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)Cc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C12H13ClF2N2O4/c13-8-1-2-9(21-12(14)15)7(3-8)4-17(5-10(16)18)6-11(19)20/h1-3,12H,4-6H2,(H2,16,18)(H,19,20) |
| InChIKey | KGHPIIXNFINFIL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |