C10H10ClF2NO3 — CID 170872496
3-amino-3-[5-chloro-2-(difluoromethoxy)phenyl]propanoic acid (PubChem CID 170872496) has the molecular formula C10H10ClF2NO3 and a molecular weight of 265.64 g/mol. Its IUPAC name is 3-amino-3-[5-chloro-2-(difluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-amino-3-[5-chloro-2-(difluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170872496 |
| Molecular Formula | C10H10ClF2NO3 |
| Molecular Weight | 265.64 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 3-amino-3-[5-chloro-2-(difluoromethoxy)phenyl]propanoic acid |
| SMILES | NC(CC(=O)O)c1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C10H10ClF2NO3/c11-5-1-2-8(17-10(12)13)6(3-5)7(14)4-9(15)16/h1-3,7,10H,4,14H2,(H,15,16) |
| InChIKey | UXVXBRWBASNXAW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |