C12H15ClF2N2O2 — CID 61464183
2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-N-methylpropanamide (PubChem CID 61464183) has the molecular formula C12H15ClF2N2O2 and a molecular weight of 292.71 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-N-methylpropanamide.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 61464183 |
| Molecular Formula | C12H15ClF2N2O2 |
| Molecular Weight | 292.71 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C12H15ClF2N2O2/c1-7(11(18)16-2)17-6-8-5-9(13)3-4-10(8)19-12(14)15/h3-5,7,12,17H,6H2,1-2H3,(H,16,18) |
| InChIKey | BOKCAACEIZZFTR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |