C15H22ClF2NO — CID 43778017
N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]heptan-2-amine (PubChem CID 43778017) has the molecular formula C15H22ClF2NO and a molecular weight of 305.80 g/mol. Its IUPAC name is N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]heptan-2-amine.
| Compound Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]heptan-2-amine |
|---|---|
| PubChem CID | 43778017 |
| Molecular Formula | C15H22ClF2NO |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C15H22ClF2NO/c1-3-4-5-6-11(2)19-10-12-9-13(16)7-8-14(12)20-15(17)18/h7-9,11,15,19H,3-6,10H2,1-2H3 |
| InChIKey | LKVYKKUBRHPOSR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|