C14H22ClNO — CID 43278029
N-[(2-butoxy-5-chlorophenyl)methyl]propan-2-amine (PubChem CID 43278029) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is N-[(2-butoxy-5-chlorophenyl)methyl]propan-2-amine.
| Compound Name | N-[(2-butoxy-5-chlorophenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 43278029 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(2-butoxy-5-chlorophenyl)methyl]propan-2-amine |
| SMILES | CCCCOc1ccc(Cl)cc1CNC(C)C |
| InChI | InChI=1S/C14H22ClNO/c1-4-5-8-17-14-7-6-13(15)9-12(14)10-16-11(2)3/h6-7,9,11,16H,4-5,8,10H2,1-3H3 |
| InChIKey | SULYVIUNIQSXOD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|