C18H30ClNO — CID 63486010
N-[(5-chloro-2-heptoxyphenyl)methyl]-2-methylpropan-1-amine (PubChem CID 63486010) has the molecular formula C18H30ClNO and a molecular weight of 311.90 g/mol. Its IUPAC name is N-[(5-chloro-2-heptoxyphenyl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(5-chloro-2-heptoxyphenyl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 63486010 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[(5-chloro-2-heptoxyphenyl)methyl]-2-methylpropan-1-amine |
| SMILES | CCCCCCCOc1ccc(Cl)cc1CNCC(C)C |
| InChI | InChI=1S/C18H30ClNO/c1-4-5-6-7-8-11-21-18-10-9-17(19)12-16(18)14-20-13-15(2)3/h9-10,12,15,20H,4-8,11,13-14H2,1-3H3 |
| InChIKey | BLMRTQQLSVVIJK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|