C15H13ClF3NO — CID 43425414
N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylaniline (PubChem CID 43425414) has the molecular formula C15H13ClF3NO and a molecular weight of 315.72 g/mol. Its IUPAC name is N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylaniline.
| Compound Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylaniline |
|---|---|
| PubChem CID | 43425414 |
| Molecular Formula | C15H13ClF3NO |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-5-fluoro-2-methylaniline |
| SMILES | Cc1ccc(F)cc1NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C15H13ClF3NO/c1-9-2-4-12(17)7-13(9)20-8-10-6-11(16)3-5-14(10)21-15(18)19/h2-7,15,20H,8H2,1H3 |
| InChIKey | YFGYGAJLHDUZFW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |