C11H11Cl2F2NO — CID 115702536
2-chloro-N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]prop-2-en-1-amine (PubChem CID 115702536) has the molecular formula C11H11Cl2F2NO and a molecular weight of 282.12 g/mol. Its IUPAC name is 2-chloro-N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]prop-2-en-1-amine.
| Compound Name | 2-chloro-N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 115702536 |
| Molecular Formula | C11H11Cl2F2NO |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 2-chloro-N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]prop-2-en-1-amine |
| SMILES | C=C(Cl)CNCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C11H11Cl2F2NO/c1-7(12)5-16-6-8-4-9(13)2-3-10(8)17-11(14)15/h2-4,11,16H,1,5-6H2 |
| InChIKey | DMELKHNLLBOCAZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |