C14H18ClF2NOS — CID 115625880
N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(thian-4-yl)methanamine (PubChem CID 115625880) has the molecular formula C14H18ClF2NOS and a molecular weight of 321.82 g/mol. Its IUPAC name is N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(thian-4-yl)methanamine.
| Compound Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(thian-4-yl)methanamine |
|---|---|
| PubChem CID | 115625880 |
| Molecular Formula | C14H18ClF2NOS |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(thian-4-yl)methanamine |
| SMILES | FC(F)Oc1ccc(Cl)cc1CNCC1CCSCC1 |
| InChI | InChI=1S/C14H18ClF2NOS/c15-12-1-2-13(19-14(16)17)11(7-12)9-18-8-10-3-5-20-6-4-10/h1-2,7,10,14,18H,3-6,8-9H2 |
| InChIKey | JLEPLOMUNICBCT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |