C13H16ClF2NOS — CID 115676105
N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]thian-3-amine (PubChem CID 115676105) has the molecular formula C13H16ClF2NOS and a molecular weight of 307.79 g/mol. Its IUPAC name is N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]thian-3-amine.
| Compound Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]thian-3-amine |
|---|---|
| PubChem CID | 115676105 |
| Molecular Formula | C13H16ClF2NOS |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]thian-3-amine |
| SMILES | FC(F)Oc1ccc(Cl)cc1CNC1CCCSC1 |
| InChI | InChI=1S/C13H16ClF2NOS/c14-10-3-4-12(18-13(15)16)9(6-10)7-17-11-2-1-5-19-8-11/h3-4,6,11,13,17H,1-2,5,7-8H2 |
| InChIKey | GLXDAKJGVPASAU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |