C14H20Cl2F2N2O — CID 119920229
1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N-methylpiperidin-3-amine;hydrochloride (PubChem CID 119920229) has the molecular formula C14H20Cl2F2N2O and a molecular weight of 341.23 g/mol. Its IUPAC name is 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N-methylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N-methylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119920229 |
| Molecular Formula | C14H20Cl2F2N2O |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N-methylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(Cc2cc(Cl)ccc2OC(F)F)C1.Cl |
| InChI | InChI=1S/C14H19ClF2N2O.ClH/c1-18-12-3-2-6-19(9-12)8-10-7-11(15)4-5-13(10)20-14(16)17;/h4-5,7,12,14,18H,2-3,6,8-9H2,1H3;1H |
| InChIKey | UESSZSJUTDLIEU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |