C15H20ClF2NO — CID 43433759
N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-methylcyclohexan-1-amine (PubChem CID 43433759) has the molecular formula C15H20ClF2NO and a molecular weight of 303.78 g/mol. Its IUPAC name is N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-methylcyclohexan-1-amine.
| Compound Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 43433759 |
| Molecular Formula | C15H20ClF2NO |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-methylcyclohexan-1-amine |
| SMILES | CC1CCCC(NCc2cc(Cl)ccc2OC(F)F)C1 |
| InChI | InChI=1S/C15H20ClF2NO/c1-10-3-2-4-13(7-10)19-9-11-8-12(16)5-6-14(11)20-15(17)18/h5-6,8,10,13,15,19H,2-4,7,9H2,1H3 |
| InChIKey | KGQWWQOBZHCFNT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |