C14H19F2NO2S — CID 103701509
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]thiolan-3-amine (PubChem CID 103701509) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]thiolan-3-amine.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 103701509 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]thiolan-3-amine |
| SMILES | CCOc1cc(CNC2CCSC2)ccc1OC(F)F |
| InChI | InChI=1S/C14H19F2NO2S/c1-2-18-13-7-10(3-4-12(13)19-14(15)16)8-17-11-5-6-20-9-11/h3-4,7,11,14,17H,2,5-6,8-9H2,1H3 |
| InChIKey | BGZLRCOXYWYQQR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |