C15H24F2N2O — CID 103720660
N-[[2-(difluoromethoxy)phenyl]methyl]-N'-ethyl-N'-propylethane-1,2-diamine (PubChem CID 103720660) has the molecular formula C15H24F2N2O and a molecular weight of 286.37 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-N'-ethyl-N'-propylethane-1,2-diamine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N'-ethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 103720660 |
| Molecular Formula | C15H24F2N2O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N'-ethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CC)CCNCc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H24F2N2O/c1-3-10-19(4-2)11-9-18-12-13-7-5-6-8-14(13)20-15(16)17/h5-8,15,18H,3-4,9-12H2,1-2H3 |
| InChIKey | CCQCRDABANMRAS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|