C14H22Cl2N2 — CID 114132479
N-[(2,3-dichlorophenyl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine (PubChem CID 114132479) has the molecular formula C14H22Cl2N2 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 114132479 |
| Molecular Formula | C14H22Cl2N2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-N'-ethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CC)CCNCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H22Cl2N2/c1-3-9-18(4-2)10-8-17-11-12-6-5-7-13(15)14(12)16/h5-7,17H,3-4,8-11H2,1-2H3 |
| InChIKey | SVNGCKPVUGOBIG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|