C12H18Cl3N — CID 17206866
N-[(2,3-dichlorophenyl)methyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 17206866) has the molecular formula C12H18Cl3N and a molecular weight of 282.64 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17206866 |
| Molecular Formula | C12H18Cl3N |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)CCNCc1cccc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C12H17Cl2N.ClH/c1-9(2)6-7-15-8-10-4-3-5-11(13)12(10)14;/h3-5,9,15H,6-8H2,1-2H3;1H |
| InChIKey | QXCFZVGYVIACAR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|