C10H18Cl2N4O2S — CID 120716096
2-amino-5-chloro-N-[2-(propylamino)ethyl]pyridine-3-sulfonamide;hydrochloride (PubChem CID 120716096) has the molecular formula C10H18Cl2N4O2S and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[2-(propylamino)ethyl]pyridine-3-sulfonamide;hydrochloride.
| Compound Name | 2-amino-5-chloro-N-[2-(propylamino)ethyl]pyridine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716096 |
| Molecular Formula | C10H18Cl2N4O2S |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-amino-5-chloro-N-[2-(propylamino)ethyl]pyridine-3-sulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cc(Cl)cnc1N.Cl |
| InChI | InChI=1S/C10H17ClN4O2S.ClH/c1-2-3-13-4-5-15-18(16,17)9-6-8(11)7-14-10(9)12;/h6-7,13,15H,2-5H2,1H3,(H2,12,14);1H |
| InChIKey | CTSFBKSWVCOKLR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|