C10H17Cl2N3O2S — CID 120716386
5-chloro-N-[2-(propylamino)ethyl]pyridine-3-sulfonamide;hydrochloride (PubChem CID 120716386) has the molecular formula C10H17Cl2N3O2S and a molecular weight of 314.24 g/mol. Its IUPAC name is 5-chloro-N-[2-(propylamino)ethyl]pyridine-3-sulfonamide;hydrochloride.
| Compound Name | 5-chloro-N-[2-(propylamino)ethyl]pyridine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716386 |
| Molecular Formula | C10H17Cl2N3O2S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 5-chloro-N-[2-(propylamino)ethyl]pyridine-3-sulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cncc(Cl)c1.Cl |
| InChI | InChI=1S/C10H16ClN3O2S.ClH/c1-2-3-12-4-5-14-17(15,16)10-6-9(11)7-13-8-10;/h6-8,12,14H,2-5H2,1H3;1H |
| InChIKey | CWVSAKIPQDXNFO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|