C12H18ClN5O4S — CID 120716049
2,4-dioxo-N-[2-(propylamino)ethyl]-1H-pyrido[2,3-d]pyrimidine-6-sulfonamide;hydrochloride (PubChem CID 120716049) has the molecular formula C12H18ClN5O4S and a molecular weight of 363.83 g/mol. Its IUPAC name is 2,4-dioxo-N-[2-(propylamino)ethyl]-1H-pyrido[2,3-d]pyrimidine-6-sulfonamide;hydrochloride.
| Compound Name | 2,4-dioxo-N-[2-(propylamino)ethyl]-1H-pyrido[2,3-d]pyrimidine-6-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716049 |
| Molecular Formula | C12H18ClN5O4S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2,4-dioxo-N-[2-(propylamino)ethyl]-1H-pyrido[2,3-d]pyrimidine-6-sulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cnc2[nH]c(=O)[nH]c(=O)c2c1.Cl |
| InChI | InChI=1S/C12H17N5O4S.ClH/c1-2-3-13-4-5-15-22(20,21)8-6-9-10(14-7-8)16-12(19)17-11(9)18;/h6-7,13,15H,2-5H2,1H3,(H2,14,16,17,18,19);1H |
| InChIKey | WLKWGRQPQZMYKC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|