C13H15N5O4S — CID 120721347
2,4-dioxo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-pyrido[2,3-d]pyrimidine-6-sulfonamide (PubChem CID 120721347) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2,4-dioxo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-pyrido[2,3-d]pyrimidine-6-sulfonamide.
| Compound Name | 2,4-dioxo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-pyrido[2,3-d]pyrimidine-6-sulfonamide |
|---|---|
| PubChem CID | 120721347 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2,4-dioxo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-pyrido[2,3-d]pyrimidine-6-sulfonamide |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)NCC3=CCNCC3)cnc2[nH]1 |
| InChI | InChI=1S/C13H15N5O4S/c19-12-10-5-9(7-15-11(10)17-13(20)18-12)23(21,22)16-6-8-1-3-14-4-2-8/h1,5,7,14,16H,2-4,6H2,(H2,15,17,18,19,20) |
| InChIKey | KRVZRTDGXBXOOT-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|