C11H18ClIN2O2S — CID 120715836
3-iodo-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120715836) has the molecular formula C11H18ClIN2O2S and a molecular weight of 404.70 g/mol. Its IUPAC name is 3-iodo-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 3-iodo-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120715836 |
| Molecular Formula | C11H18ClIN2O2S |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 3-iodo-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cccc(I)c1.Cl |
| InChI | InChI=1S/C11H17IN2O2S.ClH/c1-2-6-13-7-8-14-17(15,16)11-5-3-4-10(12)9-11;/h3-5,9,13-14H,2,6-8H2,1H3;1H |
| InChIKey | GCYGYTNYDNVGRV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|