C13H17ClN4O3S — CID 71967708
2-amino-5-chloro-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]pyridine-3-sulfonamide (PubChem CID 71967708) has the molecular formula C13H17ClN4O3S and a molecular weight of 344.82 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-chloro-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 71967708 |
| Molecular Formula | C13H17ClN4O3S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-amino-5-chloro-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]pyridine-3-sulfonamide |
| SMILES | Cc1noc(C)c1CCCNS(=O)(=O)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C13H17ClN4O3S/c1-8-11(9(2)21-18-8)4-3-5-17-22(19,20)12-6-10(14)7-16-13(12)15/h6-7,17H,3-5H2,1-2H3,(H2,15,16) |
| InChIKey | IXZDBIRBDWRPDM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|