C10H12ClFN2O2S — CID 122150384
N-(azetidin-3-yl)-2-chloro-4-fluoro-5-methylbenzenesulfonamide (PubChem CID 122150384) has the molecular formula C10H12ClFN2O2S and a molecular weight of 278.74 g/mol. Its IUPAC name is N-(azetidin-3-yl)-2-chloro-4-fluoro-5-methylbenzenesulfonamide.
| Compound Name | N-(azetidin-3-yl)-2-chloro-4-fluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122150384 |
| Molecular Formula | C10H12ClFN2O2S |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | N-(azetidin-3-yl)-2-chloro-4-fluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CNC2)c(Cl)cc1F |
| InChI | InChI=1S/C10H12ClFN2O2S/c1-6-2-10(8(11)3-9(6)12)17(15,16)14-7-4-13-5-7/h2-3,7,13-14H,4-5H2,1H3 |
| InChIKey | ODTFDDHLJLBREY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |