C17H25N3O4S2 — CID 120711765
3-(2-pyrrolidin-1-ylsulfonylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 120711765) has the molecular formula C17H25N3O4S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 3-(2-pyrrolidin-1-ylsulfonylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-(2-pyrrolidin-1-ylsulfonylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 120711765 |
| Molecular Formula | C17H25N3O4S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-(2-pyrrolidin-1-ylsulfonylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | O=S(=O)(c1ccccc1S(=O)(=O)N1CCC2CCC(C1)N2)N1CCCC1 |
| InChI | InChI=1S/C17H25N3O4S2/c21-25(22,19-10-3-4-11-19)16-5-1-2-6-17(16)26(23,24)20-12-9-14-7-8-15(13-20)18-14/h1-2,5-6,14-15,18H,3-4,7-13H2 |
| InChIKey | ZDAOPZWUQDVVOJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |