C14H26N2O5S2 — CID 90592811
2-(1-cyclohexylsulfonylpiperidin-4-yl)sulfonyl-N-methylacetamide (PubChem CID 90592811) has the molecular formula C14H26N2O5S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-(1-cyclohexylsulfonylpiperidin-4-yl)sulfonyl-N-methylacetamide.
| Compound Name | 2-(1-cyclohexylsulfonylpiperidin-4-yl)sulfonyl-N-methylacetamide |
|---|---|
| PubChem CID | 90592811 |
| Molecular Formula | C14H26N2O5S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-(1-cyclohexylsulfonylpiperidin-4-yl)sulfonyl-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(S(=O)(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C14H26N2O5S2/c1-15-14(17)11-22(18,19)12-7-9-16(10-8-12)23(20,21)13-5-3-2-4-6-13/h12-13H,2-11H2,1H3,(H,15,17) |
| InChIKey | ZTMCBHCXDBQYAV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |