C14H22N2O2S3 — CID 134160708
1-(5-methylthiophen-2-yl)sulfonyl-4-(thiolan-3-yl)-1,4-diazepane (PubChem CID 134160708) has the molecular formula C14H22N2O2S3 and a molecular weight of 346.54 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)sulfonyl-4-(thiolan-3-yl)-1,4-diazepane.
| Compound Name | 1-(5-methylthiophen-2-yl)sulfonyl-4-(thiolan-3-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 134160708 |
| Molecular Formula | C14H22N2O2S3 |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)sulfonyl-4-(thiolan-3-yl)-1,4-diazepane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(C3CCSC3)CC2)s1 |
| InChI | InChI=1S/C14H22N2O2S3/c1-12-3-4-14(20-12)21(17,18)16-7-2-6-15(8-9-16)13-5-10-19-11-13/h3-4,13H,2,5-11H2,1H3 |
| InChIKey | WMFROQVKKMZWDZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |