C19H25N3O3S — CID 122257613
2-[1-(4-tert-butylphenyl)sulfonylpiperidin-3-yl]oxypyrimidine (PubChem CID 122257613) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-[1-(4-tert-butylphenyl)sulfonylpiperidin-3-yl]oxypyrimidine.
| Compound Name | 2-[1-(4-tert-butylphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 122257613 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[1-(4-tert-butylphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCCC(Oc3ncccn3)C2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-19(2,3)15-7-9-17(10-8-15)26(23,24)22-13-4-6-16(14-22)25-18-20-11-5-12-21-18/h5,7-12,16H,4,6,13-14H2,1-3H3 |
| InChIKey | RCCRVYGPNRQOBO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |