C12H14N4O4S — CID 122257661
4-(3-pyrimidin-2-yloxypiperidin-1-yl)sulfonyl-1,2-oxazole (PubChem CID 122257661) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-(3-pyrimidin-2-yloxypiperidin-1-yl)sulfonyl-1,2-oxazole.
| Compound Name | 4-(3-pyrimidin-2-yloxypiperidin-1-yl)sulfonyl-1,2-oxazole |
|---|---|
| PubChem CID | 122257661 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-(3-pyrimidin-2-yloxypiperidin-1-yl)sulfonyl-1,2-oxazole |
| SMILES | O=S(=O)(c1cnoc1)N1CCCC(Oc2ncccn2)C1 |
| InChI | InChI=1S/C12H14N4O4S/c17-21(18,11-7-15-19-9-11)16-6-1-3-10(8-16)20-12-13-4-2-5-14-12/h2,4-5,7,9-10H,1,3,6,8H2 |
| InChIKey | NDSYVUABJGCIEZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |