C17H20ClN3O5S — CID 122259604
5-chloro-2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine (PubChem CID 122259604) has the molecular formula C17H20ClN3O5S and a molecular weight of 413.88 g/mol. Its IUPAC name is 5-chloro-2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine.
| Compound Name | 5-chloro-2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 122259604 |
| Molecular Formula | C17H20ClN3O5S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 5-chloro-2-[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(Oc3ncc(Cl)cn3)C2)cc1OC |
| InChI | InChI=1S/C17H20ClN3O5S/c1-24-15-6-5-14(8-16(15)25-2)27(22,23)21-7-3-4-13(11-21)26-17-19-9-12(18)10-20-17/h5-6,8-10,13H,3-4,7,11H2,1-2H3 |
| InChIKey | UKLRQDYOTSFYBK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |