C14H18ClN3O3S — CID 120998770
1-[2-(1,2-oxazol-5-yl)phenyl]sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 120998770) has the molecular formula C14H18ClN3O3S and a molecular weight of 343.84 g/mol. Its IUPAC name is 1-[2-(1,2-oxazol-5-yl)phenyl]sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-[2-(1,2-oxazol-5-yl)phenyl]sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120998770 |
| Molecular Formula | C14H18ClN3O3S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-[2-(1,2-oxazol-5-yl)phenyl]sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCCN(S(=O)(=O)c2ccccc2-c2ccno2)C1 |
| InChI | InChI=1S/C14H17N3O3S.ClH/c15-11-4-3-9-17(10-11)21(18,19)14-6-2-1-5-12(14)13-7-8-16-20-13;/h1-2,5-8,11H,3-4,9-10,15H2;1H |
| InChIKey | BXVGXVFGDTZQFB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |