C15H18F3NO4S — CID 122104356
6-methyl-1-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxylic acid (PubChem CID 122104356) has the molecular formula C15H18F3NO4S and a molecular weight of 365.37 g/mol. Its IUPAC name is 6-methyl-1-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122104356 |
| Molecular Formula | C15H18F3NO4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 6-methyl-1-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxylic acid |
| SMILES | Cc1ccc(C(F)(F)F)cc1S(=O)(=O)N1CC(C(=O)O)CCC1C |
| InChI | InChI=1S/C15H18F3NO4S/c1-9-3-6-12(15(16,17)18)7-13(9)24(22,23)19-8-11(14(20)21)5-4-10(19)2/h3,6-7,10-11H,4-5,8H2,1-2H3,(H,20,21) |
| InChIKey | JSJXOCHHEIMMCL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |