C13H15ClFNO4S — CID 122083294
1-(3-chloro-2-fluorophenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid (PubChem CID 122083294) has the molecular formula C13H15ClFNO4S and a molecular weight of 335.78 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(3-chloro-2-fluorophenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122083294 |
| Molecular Formula | C13H15ClFNO4S |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1S(=O)(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C13H15ClFNO4S/c1-8-5-6-9(13(17)18)7-16(8)21(19,20)11-4-2-3-10(14)12(11)15/h2-4,8-9H,5-7H2,1H3,(H,17,18) |
| InChIKey | NEABIAMIPRSVOP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |