C16H23NO4S — CID 122104341
6-methyl-1-(3-propan-2-ylphenyl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 122104341) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 6-methyl-1-(3-propan-2-ylphenyl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-(3-propan-2-ylphenyl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122104341 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 6-methyl-1-(3-propan-2-ylphenyl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | CC(C)c1cccc(S(=O)(=O)N2CC(C(=O)O)CCC2C)c1 |
| InChI | InChI=1S/C16H23NO4S/c1-11(2)13-5-4-6-15(9-13)22(20,21)17-10-14(16(18)19)8-7-12(17)3/h4-6,9,11-12,14H,7-8,10H2,1-3H3,(H,18,19) |
| InChIKey | DMKQCNKFCSOLIV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |