C14H16F3NO5S — CID 122106140
1-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonyl-5-methylpiperidine-3-carboxylic acid (PubChem CID 122106140) has the molecular formula C14H16F3NO5S and a molecular weight of 367.35 g/mol. Its IUPAC name is 1-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonyl-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonyl-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106140 |
| Molecular Formula | C14H16F3NO5S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 1-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonyl-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(S(=O)(=O)c2cc(C(F)(F)F)ccc2O)C1 |
| InChI | InChI=1S/C14H16F3NO5S/c1-8-4-9(13(20)21)7-18(6-8)24(22,23)12-5-10(14(15,16)17)2-3-11(12)19/h2-3,5,8-9,19H,4,6-7H2,1H3,(H,20,21) |
| InChIKey | OKHQIGXCZSZRCD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |