C13H15F3N2O4S — CID 122106210
5-methyl-1-[[2-(trifluoromethyl)-3-pyridinyl]sulfonyl]piperidine-3-carboxylic acid (PubChem CID 122106210) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is 5-methyl-1-[[2-(trifluoromethyl)-3-pyridinyl]sulfonyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[[2-(trifluoromethyl)-3-pyridinyl]sulfonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106210 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 5-methyl-1-[[2-(trifluoromethyl)-3-pyridinyl]sulfonyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(S(=O)(=O)c2cccnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H15F3N2O4S/c1-8-5-9(12(19)20)7-18(6-8)23(21,22)10-3-2-4-17-11(10)13(14,15)16/h2-4,8-9H,5-7H2,1H3,(H,19,20) |
| InChIKey | YBOWKHCJBKHGFM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |