C9H11F3N2OS — CID 90993979
5-[2-(amino-methyl-oxo-λ6-sulfanylidene)ethyl]-2-(trifluoromethyl)pyridine (PubChem CID 90993979) has the molecular formula C9H11F3N2OS and a molecular weight of 252.26 g/mol. Its IUPAC name is 5-[2-(amino-methyl-oxo-λ6-sulfanylidene)ethyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[2-(amino-methyl-oxo-λ6-sulfanylidene)ethyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 90993979 |
| Molecular Formula | C9H11F3N2OS |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 5-[2-(amino-methyl-oxo-λ6-sulfanylidene)ethyl]-2-(trifluoromethyl)pyridine |
| SMILES | CS(N)(=O)=CCc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C9H11F3N2OS/c1-16(13,15)5-4-7-2-3-8(14-6-7)9(10,11)12/h2-3,5-6H,4H2,1H3,(H2,13,15) |
| InChIKey | JPHGYQBSHGUABI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|