C10H10F3N3O2S — CID 90020042
cyano-[methyl-oxo-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]-oxidoazanium (PubChem CID 90020042) has the molecular formula C10H10F3N3O2S and a molecular weight of 293.27 g/mol. Its IUPAC name is cyano-[methyl-oxo-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]-oxidoazanium.
| Compound Name | cyano-[methyl-oxo-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]-oxidoazanium |
|---|---|
| PubChem CID | 90020042 |
| Molecular Formula | C10H10F3N3O2S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | cyano-[methyl-oxo-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]-oxidoazanium |
| SMILES | CS(=O)(CCc1ccc(C(F)(F)F)nc1)=[N+]([O-])C#N |
| InChI | InChI=1S/C10H10F3N3O2S/c1-19(18,16(17)7-14)5-4-8-2-3-9(15-6-8)10(11,12)13/h2-3,6H,4-5H2,1H3 |
| InChIKey | PTVNHRZDTJSJPM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|