C9H10F3N3O3S — CID 59218591
N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]nitramide (PubChem CID 59218591) has the molecular formula C9H10F3N3O3S and a molecular weight of 297.26 g/mol. Its IUPAC name is N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]nitramide.
| Compound Name | N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]nitramide |
|---|---|
| PubChem CID | 59218591 |
| Molecular Formula | C9H10F3N3O3S |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]nitramide |
| SMILES | CC(c1ccc(C(F)(F)F)nc1)S(C)(=O)=N[N+](=O)[O-] |
| InChI | InChI=1S/C9H10F3N3O3S/c1-6(19(2,18)14-15(16)17)7-3-4-8(13-5-7)9(10,11)12/h3-6H,1-2H3 |
| InChIKey | TZUAPQRKXXEVQO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|