C14H18F2N4O2S — CID 122177268
[1-[6-(1,1-difluoro-4-methoxyiminobutyl)-3-pyridinyl]ethyl-methyl-oxo-λ6-sulfanylidene]cyanamide (PubChem CID 122177268) has the molecular formula C14H18F2N4O2S and a molecular weight of 344.39 g/mol. Its IUPAC name is [1-[6-(1,1-difluoro-4-methoxyiminobutyl)-3-pyridinyl]ethyl-methyl-oxo-λ6-sulfanylidene]cyanamide.
| Compound Name | [1-[6-(1,1-difluoro-4-methoxyiminobutyl)-3-pyridinyl]ethyl-methyl-oxo-λ6-sulfanylidene]cyanamide |
|---|---|
| PubChem CID | 122177268 |
| Molecular Formula | C14H18F2N4O2S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [1-[6-(1,1-difluoro-4-methoxyiminobutyl)-3-pyridinyl]ethyl-methyl-oxo-λ6-sulfanylidene]cyanamide |
| SMILES | CON=CCCC(F)(F)c1ccc(C(C)S(C)(=O)=NC#N)cn1 |
| InChI | InChI=1S/C14H18F2N4O2S/c1-11(23(3,21)20-10-17)12-5-6-13(18-9-12)14(15,16)7-4-8-19-22-2/h5-6,8-9,11H,4,7H2,1-3H3 |
| InChIKey | ZEFPWRSXVTWVRD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|