C14H19F3N2O2S — CID 91031568
2,2-dimethyl-N-[methyl-oxo-[2-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]propanamide (PubChem CID 91031568) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-[methyl-oxo-[2-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[methyl-oxo-[2-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]propanamide |
|---|---|
| PubChem CID | 91031568 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2,2-dimethyl-N-[methyl-oxo-[2-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]propanamide |
| SMILES | CC(C)(C)C(=O)NS(C)(=O)=CCc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H19F3N2O2S/c1-13(2,3)12(20)19-22(4,21)8-7-10-5-6-11(18-9-10)14(15,16)17/h5-6,8-9H,7H2,1-4H3,(H,19,20,21) |
| InChIKey | OWAMDDLLNZJTEA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|